C13H10F2N4O2S2 — CID 122276028
3,4-difluoro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzenesulfonamide (PubChem CID 122276028) has the molecular formula C13H10F2N4O2S2 and a molecular weight of 356.38 g/mol. Its IUPAC name is 3,4-difluoro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122276028 |
| Molecular Formula | C13H10F2N4O2S2 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 3,4-difluoro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cn(-c2ccsc2)nn1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H10F2N4O2S2/c14-12-2-1-11(5-13(12)15)23(20,21)16-6-9-7-19(18-17-9)10-3-4-22-8-10/h1-5,7-8,16H,6H2 |
| InChIKey | MJFQBXWBEWPWNB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |