C15H18FNO2 — CID 122276126
4-fluoro-N-(7-oxaspiro[3.5]nonan-3-yl)benzamide (PubChem CID 122276126) has the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. Its IUPAC name is 4-fluoro-N-(7-oxaspiro[3.5]nonan-3-yl)benzamide.
| Compound Name | 4-fluoro-N-(7-oxaspiro[3.5]nonan-3-yl)benzamide |
|---|---|
| PubChem CID | 122276126 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-fluoro-N-(7-oxaspiro[3.5]nonan-3-yl)benzamide |
| SMILES | O=C(NC1CCC12CCOCC2)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H18FNO2/c16-12-3-1-11(2-4-12)14(18)17-13-5-6-15(13)7-9-19-10-8-15/h1-4,13H,5-10H2,(H,17,18) |
| InChIKey | GRFFLKHUTMOYAH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |