C18H17N7O2S — CID 122276911
3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]carbamate (PubChem CID 122276911) has the molecular formula C18H17N7O2S and a molecular weight of 395.45 g/mol. Its IUPAC name is 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]carbamate.
| Compound Name | 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 122276911 |
| Molecular Formula | C18H17N7O2S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]carbamate |
| SMILES | O=C(NCc1nccnc1-c1ccsc1)OCCCc1cnc2ncnn2c1 |
| InChI | InChI=1S/C18H17N7O2S/c26-18(22-9-15-16(20-5-4-19-15)14-3-7-28-11-14)27-6-1-2-13-8-21-17-23-12-24-25(17)10-13/h3-5,7-8,10-12H,1-2,6,9H2,(H,22,26) |
| InChIKey | PSWRETHTHASOLM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|