C21H30N4O2 — CID 122277592
1-(1-adamantyl)-3-[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)ethyl]urea (PubChem CID 122277592) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)ethyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 122277592 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 1-(1-adamantyl)-3-[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)ethyl]urea |
| SMILES | O=C(NCCn1nc2c(cc1=O)CCCC2)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H30N4O2/c26-19-10-17-3-1-2-4-18(17)24-25(19)6-5-22-20(27)23-21-11-14-7-15(12-21)9-16(8-14)13-21/h10,14-16H,1-9,11-13H2,(H2,22,23,27) |
| InChIKey | CKFMYIUSKHMNBZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |