C16H17ClN4O2 — CID 122278171
1-(2-chlorophenyl)-3-[2-(3-cyclopropyl-6-oxopyridazin-1-yl)ethyl]urea (PubChem CID 122278171) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[2-(3-cyclopropyl-6-oxopyridazin-1-yl)ethyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[2-(3-cyclopropyl-6-oxopyridazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 122278171 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[2-(3-cyclopropyl-6-oxopyridazin-1-yl)ethyl]urea |
| SMILES | O=C(NCCn1nc(C2CC2)ccc1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H17ClN4O2/c17-12-3-1-2-4-14(12)19-16(23)18-9-10-21-15(22)8-7-13(20-21)11-5-6-11/h1-4,7-8,11H,5-6,9-10H2,(H2,18,19,23) |
| InChIKey | CKTRPEJFKIWLHD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |