About 6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one
6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one (PubChem CID 122279082) has the molecular formula C15H19F2N3O2
and a molecular weight of 311.33 g/mol. Its IUPAC name is 6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one.
Molecular Properties
| Compound Name | 6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one |
| PubChem CID | 122279082 |
| Molecular Formula | C15H19F2N3O2 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one |
| SMILES | CC(C(=O)N1CCC(F)(F)CC1)n1nc(C2CC2)ccc1=O |
| InChI | InChI=1S/C15H19F2N3O2/c1-10(14(22)19-8-6-15(16,17)7-9-19)20-13(21)5-4-12(18-20)11-2-3-11/h4-5,10-11H,2-3,6-9H2,1H3 |
| InChIKey | QLHYSGMWZRCWQT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one?
The IUPAC name of 6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one (CID 122279082) is 6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one.
What is the SMILES notation for 6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one?
The canonical SMILES for 6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one is CC(C(=O)N1CCC(F)(F)CC1)n1nc(C2CC2)ccc1=O.
What is the InChIKey of 6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one?
The InChIKey is QLHYSGMWZRCWQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2N3O2/c1-10(14(22)19-8-6-15(16,17)7-9-19)20-13(21)5-4-12(18-20)11-2-3-11/h4-5,10-11H,2-3,6-9H2,1H3.
What are the key properties of 6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one?
6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one has a molecular weight of 311.33 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-2-[1-(4,4-difluoropiperidin-1-yl)-1-oxopropan-2-yl]pyridazin-3-one is sourced from PubChem (CID 122279082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).