C17H17FN6O — CID 122281789
6-(4-fluorophenyl)-2-[2-[[6-(methylamino)pyrimidin-4-yl]amino]ethyl]pyridazin-3-one (PubChem CID 122281789) has the molecular formula C17H17FN6O and a molecular weight of 340.36 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2-[2-[[6-(methylamino)pyrimidin-4-yl]amino]ethyl]pyridazin-3-one.
| Compound Name | 6-(4-fluorophenyl)-2-[2-[[6-(methylamino)pyrimidin-4-yl]amino]ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 122281789 |
| Molecular Formula | C17H17FN6O |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 6-(4-fluorophenyl)-2-[2-[[6-(methylamino)pyrimidin-4-yl]amino]ethyl]pyridazin-3-one |
| SMILES | CNc1cc(NCCn2nc(-c3ccc(F)cc3)ccc2=O)ncn1 |
| InChI | InChI=1S/C17H17FN6O/c1-19-15-10-16(22-11-21-15)20-8-9-24-17(25)7-6-14(23-24)12-2-4-13(18)5-3-12/h2-7,10-11H,8-9H2,1H3,(H2,19,20,21,22) |
| InChIKey | LIRSFJKFLGBRRF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |