C11H18N4 — CID 122281906
6-N-cyclopentyl-4-N,4-N-dimethylpyrimidine-4,6-diamine (PubChem CID 122281906) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 6-N-cyclopentyl-4-N,4-N-dimethylpyrimidine-4,6-diamine.
| Compound Name | 6-N-cyclopentyl-4-N,4-N-dimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 122281906 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 6-N-cyclopentyl-4-N,4-N-dimethylpyrimidine-4,6-diamine |
| SMILES | CN(C)c1cc(NC2CCCC2)ncn1 |
| InChI | InChI=1S/C11H18N4/c1-15(2)11-7-10(12-8-13-11)14-9-5-3-4-6-9/h7-9H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | ZZCGAJNFRGUWML-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |