C22H19N5O2 — CID 122282988
5-pyridin-3-yl-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 122282988) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 5-pyridin-3-yl-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-pyridin-3-yl-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 122282988 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 5-pyridin-3-yl-N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1cn2c(n1)CCCC2)c1cc(-c2cccnc2)on1 |
| InChI | InChI=1S/C22H19N5O2/c28-22(18-12-20(29-26-18)15-6-5-10-23-13-15)25-17-8-2-1-7-16(17)19-14-27-11-4-3-9-21(27)24-19/h1-2,5-8,10,12-14H,3-4,9,11H2,(H,25,28) |
| InChIKey | JHEKZMJPBUTJIK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |