C21H14F3N3O — CID 122284520
2,3,4-trifluoro-N-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide (PubChem CID 122284520) has the molecular formula C21H14F3N3O and a molecular weight of 381.36 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 122284520 |
| Molecular Formula | C21H14F3N3O |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2,3,4-trifluoro-N-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide |
| SMILES | Cc1cccn2cc(-c3ccc(NC(=O)c4ccc(F)c(F)c4F)cc3)nc12 |
| InChI | InChI=1S/C21H14F3N3O/c1-12-3-2-10-27-11-17(26-20(12)27)13-4-6-14(7-5-13)25-21(28)15-8-9-16(22)19(24)18(15)23/h2-11H,1H3,(H,25,28) |
| InChIKey | SIODBNHQQJHRPW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|