About E-1-(2,4,6-trimethylphenyl)ethanone oxime
E-1-(2,4,6-trimethylphenyl)ethanone oxime (PubChem CID 12228534) has the molecular formula C11H15NO
and a molecular weight of 177.24 g/mol. Its IUPAC name is (NE)-N-[1-(2,4,6-trimethylphenyl)ethylidene]hydroxylamine.
Molecular Properties
| Compound Name | E-1-(2,4,6-trimethylphenyl)ethanone oxime |
| PubChem CID | 12228534 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (NE)-N-[1-(2,4,6-trimethylphenyl)ethylidene]hydroxylamine |
| SMILES | CC1=CC(=C(C(=C1)C)/C(=N/O)/C)C |
| InChI | InChI=1S/C11H15NO/c1-7-5-8(2)11(9(3)6-7)10(4)12-13/h5-6,13H,1-4H3/b12-10+ |
| InChIKey | UIVGQGKUFWHBFI-ZRDIBKRKSA-N |
| XLogP | 3.00 |
| TPSA | 32.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | 188 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze E-1-(2,4,6-trimethylphenyl)ethanone oxime with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of E-1-(2,4,6-trimethylphenyl)ethanone oxime?
The IUPAC name of E-1-(2,4,6-trimethylphenyl)ethanone oxime (CID 12228534) is (NE)-N-[1-(2,4,6-trimethylphenyl)ethylidene]hydroxylamine.
What is the SMILES notation for E-1-(2,4,6-trimethylphenyl)ethanone oxime?
The canonical SMILES for E-1-(2,4,6-trimethylphenyl)ethanone oxime is CC1=CC(=C(C(=C1)C)/C(=N/O)/C)C.
What is the InChIKey of E-1-(2,4,6-trimethylphenyl)ethanone oxime?
The InChIKey is UIVGQGKUFWHBFI-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H15NO/c1-7-5-8(2)11(9(3)6-7)10(4)12-13/h5-6,13H,1-4H3/b12-10+.
What are the key properties of E-1-(2,4,6-trimethylphenyl)ethanone oxime?
E-1-(2,4,6-trimethylphenyl)ethanone oxime has a molecular weight of 177.24 g/mol, XLogP of 3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for E-1-(2,4,6-trimethylphenyl)ethanone oxime is sourced from PubChem (CID 12228534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).