C19H19N5O4S — CID 122285690
2-(2,6-dioxopiperidin-1-yl)-N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)ethanesulfonamide (PubChem CID 122285690) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-1-yl)-N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)ethanesulfonamide.
| Compound Name | 2-(2,6-dioxopiperidin-1-yl)-N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 122285690 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-(2,6-dioxopiperidin-1-yl)-N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)ethanesulfonamide |
| SMILES | O=C1CCCC(=O)N1CCS(=O)(=O)Nc1ccc(-c2cn3cccnc3n2)cc1 |
| InChI | InChI=1S/C19H19N5O4S/c25-17-3-1-4-18(26)24(17)11-12-29(27,28)22-15-7-5-14(6-8-15)16-13-23-10-2-9-20-19(23)21-16/h2,5-10,13,22H,1,3-4,11-12H2 |
| InChIKey | XOYUPBFEWFOKOI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|