About N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide
N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide (PubChem CID 122286575) has the molecular formula C16H16N4OS2
and a molecular weight of 344.47 g/mol. Its IUPAC name is N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide |
| PubChem CID | 122286575 |
| Molecular Formula | C16H16N4OS2 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)Nc1ccc(-c2csc(C)n2)cc1 |
| InChI | InChI=1S/C16H16N4OS2/c1-3-4-13-15(23-20-19-13)16(21)18-12-7-5-11(6-8-12)14-9-22-10(2)17-14/h5-9H,3-4H2,1-2H3,(H,18,21) |
| InChIKey | HMBNKISEAPWKQI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide?
The IUPAC name of N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide (CID 122286575) is N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide.
What is the SMILES notation for N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide?
The canonical SMILES for N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide is CCCc1nnsc1C(=O)Nc1ccc(-c2csc(C)n2)cc1.
What is the InChIKey of N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide?
The InChIKey is HMBNKISEAPWKQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4OS2/c1-3-4-13-15(23-20-19-13)16(21)18-12-7-5-11(6-8-12)14-9-22-10(2)17-14/h5-9H,3-4H2,1-2H3,(H,18,21).
What are the key properties of N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide?
N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide has a molecular weight of 344.47 g/mol, XLogP of 4.17, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-propylthiadiazole-5-carboxamide is sourced from PubChem (CID 122286575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).