C16H22N8O2S — CID 122289781
N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-1,2-dimethylimidazole-4-sulfonamide (PubChem CID 122289781) has the molecular formula C16H22N8O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-1,2-dimethylimidazole-4-sulfonamide.
| Compound Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-1,2-dimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122289781 |
| Molecular Formula | C16H22N8O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-1,2-dimethylimidazole-4-sulfonamide |
| SMILES | Cc1cc(C)n(-c2cc(NCCNS(=O)(=O)c3cn(C)c(C)n3)ncn2)n1 |
| InChI | InChI=1S/C16H22N8O2S/c1-11-7-12(2)24(22-11)15-8-14(18-10-19-15)17-5-6-20-27(25,26)16-9-23(4)13(3)21-16/h7-10,20H,5-6H2,1-4H3,(H,17,18,19) |
| InChIKey | ZJPUUPIEDUIHSB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|