C20H29N5O3S — CID 122293627
N-[2-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2-(4-propan-2-ylsulfonylphenyl)acetamide (PubChem CID 122293627) has the molecular formula C20H29N5O3S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[2-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2-(4-propan-2-ylsulfonylphenyl)acetamide.
| Compound Name | N-[2-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2-(4-propan-2-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 122293627 |
| Molecular Formula | C20H29N5O3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[2-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2-(4-propan-2-ylsulfonylphenyl)acetamide |
| SMILES | Cc1nc(NCCNC(=O)Cc2ccc(S(=O)(=O)C(C)C)cc2)cc(N(C)C)n1 |
| InChI | InChI=1S/C20H29N5O3S/c1-14(2)29(27,28)17-8-6-16(7-9-17)12-20(26)22-11-10-21-18-13-19(25(4)5)24-15(3)23-18/h6-9,13-14H,10-12H2,1-5H3,(H,22,26)(H,21,23,24) |
| InChIKey | APCDJKBOIRVRPL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|