C22H27N7O2 — CID 122294459
N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-2-(4-oxoquinazolin-3-yl)acetamide (PubChem CID 122294459) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-2-(4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-2-(4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 122294459 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-2-(4-oxoquinazolin-3-yl)acetamide |
| SMILES | Cc1cc(N2CCCCC2)nc(NCCNC(=O)Cn2cnc3ccccc3c2=O)n1 |
| InChI | InChI=1S/C22H27N7O2/c1-16-13-19(28-11-5-2-6-12-28)27-22(26-16)24-10-9-23-20(30)14-29-15-25-18-8-4-3-7-17(18)21(29)31/h3-4,7-8,13,15H,2,5-6,9-12,14H2,1H3,(H,23,30)(H,24,26,27) |
| InChIKey | QLFQUKRAWCEYDG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|