C17H22FN5O2 — CID 122295393
N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-(2-fluorophenoxy)acetamide (PubChem CID 122295393) has the molecular formula C17H22FN5O2 and a molecular weight of 347.39 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-(2-fluorophenoxy)acetamide.
| Compound Name | N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-(2-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 122295393 |
| Molecular Formula | C17H22FN5O2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-(2-fluorophenoxy)acetamide |
| SMILES | Cc1cc(N(C)C)nc(NCCNC(=O)COc2ccccc2F)n1 |
| InChI | InChI=1S/C17H22FN5O2/c1-12-10-15(23(2)3)22-17(21-12)20-9-8-19-16(24)11-25-14-7-5-4-6-13(14)18/h4-7,10H,8-9,11H2,1-3H3,(H,19,24)(H,20,21,22) |
| InChIKey | JDXUBCCPAAUNFY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|