C18H23N5O3 — CID 122295408
N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 122295408) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 122295408 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | Cc1cc(N(C)C)nc(NCCNC(=O)C2COc3ccccc3O2)n1 |
| InChI | InChI=1S/C18H23N5O3/c1-12-10-16(23(2)3)22-18(21-12)20-9-8-19-17(24)15-11-25-13-6-4-5-7-14(13)26-15/h4-7,10,15H,8-9,11H2,1-3H3,(H,19,24)(H,20,21,22) |
| InChIKey | NHJMMEFVSNNTOP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|