C13H20N8O — CID 122295428
N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-methyltriazole-4-carboxamide (PubChem CID 122295428) has the molecular formula C13H20N8O and a molecular weight of 304.36 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-methyltriazole-4-carboxamide.
| Compound Name | N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 122295428 |
| Molecular Formula | C13H20N8O |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-methyltriazole-4-carboxamide |
| SMILES | Cc1cc(N(C)C)nc(NCCNC(=O)c2cn(C)nn2)n1 |
| InChI | InChI=1S/C13H20N8O/c1-9-7-11(20(2)3)17-13(16-9)15-6-5-14-12(22)10-8-21(4)19-18-10/h7-8H,5-6H2,1-4H3,(H,14,22)(H,15,16,17) |
| InChIKey | LWYHWZCXQKABIL-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|