C22H22N6O3S — CID 122297534
4-cyano-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]benzenesulfonamide (PubChem CID 122297534) has the molecular formula C22H22N6O3S and a molecular weight of 450.52 g/mol. Its IUPAC name is 4-cyano-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122297534 |
| Molecular Formula | C22H22N6O3S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 4-cyano-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]benzenesulfonamide |
| SMILES | Cc1nc(Nc2ccc(NS(=O)(=O)c3ccc(C#N)cc3)cc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C22H22N6O3S/c1-16-24-21(14-22(25-16)28-10-12-31-13-11-28)26-18-4-6-19(7-5-18)27-32(29,30)20-8-2-17(15-23)3-9-20/h2-9,14,27H,10-13H2,1H3,(H,24,25,26) |
| InChIKey | ZFLUXODVKZDFNP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |