C14H12F3N3O2 — CID 122301631
N-(2-methoxypyrimidin-5-yl)-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 122301631) has the molecular formula C14H12F3N3O2 and a molecular weight of 311.26 g/mol. Its IUPAC name is N-(2-methoxypyrimidin-5-yl)-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-(2-methoxypyrimidin-5-yl)-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 122301631 |
| Molecular Formula | C14H12F3N3O2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(2-methoxypyrimidin-5-yl)-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ncc(NC(=O)Cc2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C14H12F3N3O2/c1-22-13-18-7-11(8-19-13)20-12(21)6-9-2-4-10(5-3-9)14(15,16)17/h2-5,7-8H,6H2,1H3,(H,20,21) |
| InChIKey | DLXPHXJSFSDKBO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |