About N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide
N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 1223033) has the molecular formula C23H24N2O3
and a molecular weight of 376.46 g/mol. Its IUPAC name is N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide |
| PubChem CID | 1223033 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NC3CCCC3)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C23H24N2O3/c1-27-21-12-11-15(13-22(21)28-2)20-14-18(17-9-5-6-10-19(17)25-20)23(26)24-16-7-3-4-8-16/h5-6,9-14,16H,3-4,7-8H2,1-2H3,(H,24,26) |
| InChIKey | DEGVEGIKCMPYJW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide?
The IUPAC name of N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide (CID 1223033) is N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide.
What is the SMILES notation for N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide?
The canonical SMILES for N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide is COc1ccc(-c2cc(C(=O)NC3CCCC3)c3ccccc3n2)cc1OC.
What is the InChIKey of N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide?
The InChIKey is DEGVEGIKCMPYJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N2O3/c1-27-21-12-11-15(13-22(21)28-2)20-14-18(17-9-5-6-10-19(17)25-20)23(26)24-16-7-3-4-8-16/h5-6,9-14,16H,3-4,7-8H2,1-2H3,(H,24,26).
What are the key properties of N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide?
N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide has a molecular weight of 376.46 g/mol, XLogP of 4.59, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxamide is sourced from PubChem (CID 1223033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).