C17H13FN4O5 — CID 122303336
N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-5-nitrofuran-2-carboxamide (PubChem CID 122303336) has the molecular formula C17H13FN4O5 and a molecular weight of 372.31 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 122303336 |
| Molecular Formula | C17H13FN4O5 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-5-nitrofuran-2-carboxamide |
| SMILES | Cc1nc(Oc2ccccc2F)nc(C)c1NC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C17H13FN4O5/c1-9-15(21-16(23)13-7-8-14(26-13)22(24)25)10(2)20-17(19-9)27-12-6-4-3-5-11(12)18/h3-8H,1-2H3,(H,21,23) |
| InChIKey | YEEBFEFPABSTOA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|