C16H18ClN3O4 — CID 122304290
2-(4-chlorophenoxy)-N-(2,4-diethoxypyrimidin-5-yl)acetamide (PubChem CID 122304290) has the molecular formula C16H18ClN3O4 and a molecular weight of 351.79 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-(2,4-diethoxypyrimidin-5-yl)acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-(2,4-diethoxypyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 122304290 |
| Molecular Formula | C16H18ClN3O4 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-(2,4-diethoxypyrimidin-5-yl)acetamide |
| SMILES | CCOc1ncc(NC(=O)COc2ccc(Cl)cc2)c(OCC)n1 |
| InChI | InChI=1S/C16H18ClN3O4/c1-3-22-15-13(9-18-16(20-15)23-4-2)19-14(21)10-24-12-7-5-11(17)6-8-12/h5-9H,3-4,10H2,1-2H3,(H,19,21) |
| InChIKey | UWRVGLIXRKDVIC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |