C21H19N5O4S — CID 122304738
2-methoxy-5-methyl-N-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]benzenesulfonamide (PubChem CID 122304738) has the molecular formula C21H19N5O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is 2-methoxy-5-methyl-N-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]benzenesulfonamide.
| Compound Name | 2-methoxy-5-methyl-N-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122304738 |
| Molecular Formula | C21H19N5O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-methoxy-5-methyl-N-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]benzenesulfonamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)Nc1ccc(Oc2ccc(-n3cccn3)nn2)cc1 |
| InChI | InChI=1S/C21H19N5O4S/c1-15-4-9-18(29-2)19(14-15)31(27,28)25-16-5-7-17(8-6-16)30-21-11-10-20(23-24-21)26-13-3-12-22-26/h3-14,25H,1-2H3 |
| InChIKey | MMODPAANEIQHFW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |