About 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea
1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea (PubChem CID 122304761) has the molecular formula C22H14F6N6O2
and a molecular weight of 508.38 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea |
| PubChem CID | 122304761 |
| Molecular Formula | C22H14F6N6O2 |
| Molecular Weight | 508.38 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea |
| SMILES | O=C(Nc1ccc(Oc2ccc(-n3cccn3)nn2)cc1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H14F6N6O2/c23-21(24,25)13-10-14(22(26,27)28)12-16(11-13)31-20(35)30-15-2-4-17(5-3-15)36-19-7-6-18(32-33-19)34-9-1-8-29-34/h1-12H,(H2,30,31,35) |
| InChIKey | YNCHSHMLPKPLLD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.38 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea (CID 122304761) is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea is O=C(Nc1ccc(Oc2ccc(-n3cccn3)nn2)cc1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea?
The InChIKey is YNCHSHMLPKPLLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14F6N6O2/c23-21(24,25)13-10-14(22(26,27)28)12-16(11-13)31-20(35)30-15-2-4-17(5-3-15)36-19-7-6-18(32-33-19)34-9-1-8-29-34/h1-12H,(H2,30,31,35).
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea?
1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea has a molecular weight of 508.38 g/mol, XLogP of 6.14, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]urea is sourced from PubChem (CID 122304761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).