C24H25N5O4S — CID 122305101
4-butoxy-N-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]oxyphenyl]benzenesulfonamide (PubChem CID 122305101) has the molecular formula C24H25N5O4S and a molecular weight of 479.56 g/mol. Its IUPAC name is 4-butoxy-N-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]oxyphenyl]benzenesulfonamide.
| Compound Name | 4-butoxy-N-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]oxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122305101 |
| Molecular Formula | C24H25N5O4S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 4-butoxy-N-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]oxyphenyl]benzenesulfonamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)Nc2ccc(Oc3ccc(-n4ccc(C)n4)nn3)cc2)cc1 |
| InChI | InChI=1S/C24H25N5O4S/c1-3-4-17-32-20-9-11-22(12-10-20)34(30,31)28-19-5-7-21(8-6-19)33-24-14-13-23(25-26-24)29-16-15-18(2)27-29/h5-16,28H,3-4,17H2,1-2H3 |
| InChIKey | WTSJJVZWMQHHJE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|