C24H21N5O4 — CID 122306183
(E)-3-(3,4-dimethoxyphenyl)-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]prop-2-enamide (PubChem CID 122306183) has the molecular formula C24H21N5O4 and a molecular weight of 443.46 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122306183 |
| Molecular Formula | C24H21N5O4 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc(Oc3ccc(-n4ccnc4)nn3)cc2)cc1OC |
| InChI | InChI=1S/C24H21N5O4/c1-31-20-9-3-17(15-21(20)32-2)4-11-23(30)26-18-5-7-19(8-6-18)33-24-12-10-22(27-28-24)29-14-13-25-16-29/h3-16H,1-2H3,(H,26,30)/b11-4+ |
| InChIKey | FJEDFDMMMCAOCZ-NYYWCZLTSA-N |
| XLogP | 4.12 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|