C22H20N6O2 — CID 122306212
1-(2,4-dimethylphenyl)-3-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]urea (PubChem CID 122306212) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]urea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 122306212 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(Oc3ccc(-n4ccnc4)nn3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H20N6O2/c1-15-3-8-19(16(2)13-15)25-22(29)24-17-4-6-18(7-5-17)30-21-10-9-20(26-27-21)28-12-11-23-14-28/h3-14H,1-2H3,(H2,24,25,29) |
| InChIKey | OEAYHXPRRAPWGQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |