C17H16BrN5O — CID 122307616
4-bromo-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]benzamide (PubChem CID 122307616) has the molecular formula C17H16BrN5O and a molecular weight of 386.25 g/mol. Its IUPAC name is 4-bromo-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122307616 |
| Molecular Formula | C17H16BrN5O |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 4-bromo-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]benzamide |
| SMILES | O=C(NCCNc1ccc(-n2cccc2)nn1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16BrN5O/c18-14-5-3-13(4-6-14)17(24)20-10-9-19-15-7-8-16(22-21-15)23-11-1-2-12-23/h1-8,11-12H,9-10H2,(H,19,21)(H,20,24) |
| InChIKey | RZVVDAYWDVKVHK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|