C21H15F3N4O3S — CID 122307777
N-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 122307777) has the molecular formula C21H15F3N4O3S and a molecular weight of 460.44 g/mol. Its IUPAC name is N-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 122307777 |
| Molecular Formula | C21H15F3N4O3S |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | N-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Oc2ccc(-n3cccc3)nn2)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H15F3N4O3S/c22-21(23,24)15-4-3-5-18(14-15)32(29,30)27-16-6-8-17(9-7-16)31-20-11-10-19(25-26-20)28-12-1-2-13-28/h1-14,27H |
| InChIKey | BSHWNRYMRZSWNU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |