C17H22F3NO2 — CID 1223091
N-cycloheptyl-3-(2,2,2-trifluoroethoxymethyl)benzamide (PubChem CID 1223091) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-cycloheptyl-3-(2,2,2-trifluoroethoxymethyl)benzamide.
| Compound Name | N-cycloheptyl-3-(2,2,2-trifluoroethoxymethyl)benzamide |
|---|---|
| PubChem CID | 1223091 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-cycloheptyl-3-(2,2,2-trifluoroethoxymethyl)benzamide |
| SMILES | O=C(NC1CCCCCC1)c1cccc(COCC(F)(F)F)c1 |
| InChI | InChI=1S/C17H22F3NO2/c18-17(19,20)12-23-11-13-6-5-7-14(10-13)16(22)21-15-8-3-1-2-4-9-15/h5-7,10,15H,1-4,8-9,11-12H2,(H,21,22) |
| InChIKey | FQECYODDXMQVMR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |