C21H15F3N6O2S — CID 122309727
1-[4-(6-pyrazol-1-ylpyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 122309727) has the molecular formula C21H15F3N6O2S and a molecular weight of 472.45 g/mol. Its IUPAC name is 1-[4-(6-pyrazol-1-ylpyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-[4-(6-pyrazol-1-ylpyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 122309727 |
| Molecular Formula | C21H15F3N6O2S |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 1-[4-(6-pyrazol-1-ylpyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Oc2cc(-n3cccn3)ncn2)cc1)Nc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H15F3N6O2S/c22-21(23,24)33-17-8-4-15(5-9-17)29-20(31)28-14-2-6-16(7-3-14)32-19-12-18(25-13-26-19)30-11-1-10-27-30/h1-13H,(H2,28,29,31) |
| InChIKey | GETWMOUVDXATOZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |