C26H29N5O2 — CID 122312778
N-[4-[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]oxyphenyl]adamantane-1-carboxamide (PubChem CID 122312778) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[4-[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]oxyphenyl]adamantane-1-carboxamide.
| Compound Name | N-[4-[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]oxyphenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 122312778 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | N-[4-[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]oxyphenyl]adamantane-1-carboxamide |
| SMILES | Cc1nc(Oc2ccc(NC(=O)C34CC5CC(CC(C5)C3)C4)cc2)cc(-n2ccnc2C)n1 |
| InChI | InChI=1S/C26H29N5O2/c1-16-28-23(31-8-7-27-17(31)2)12-24(29-16)33-22-5-3-21(4-6-22)30-25(32)26-13-18-9-19(14-26)11-20(10-18)15-26/h3-8,12,18-20H,9-11,13-15H2,1-2H3,(H,30,32) |
| InChIKey | FTLFVXCZTKEHFR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |