C16H20F3NO2 — CID 1223159
N-cyclohexyl-3-(2,2,2-trifluoroethoxymethyl)benzamide (PubChem CID 1223159) has the molecular formula C16H20F3NO2 and a molecular weight of 315.34 g/mol. Its IUPAC name is N-cyclohexyl-3-(2,2,2-trifluoroethoxymethyl)benzamide.
| Compound Name | N-cyclohexyl-3-(2,2,2-trifluoroethoxymethyl)benzamide |
|---|---|
| PubChem CID | 1223159 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-cyclohexyl-3-(2,2,2-trifluoroethoxymethyl)benzamide |
| SMILES | O=C(NC1CCCCC1)c1cccc(COCC(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F3NO2/c17-16(18,19)11-22-10-12-5-4-6-13(9-12)15(21)20-14-7-2-1-3-8-14/h4-6,9,14H,1-3,7-8,10-11H2,(H,20,21) |
| InChIKey | BSNMCBNRQQVMIR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |