C23H26N6O — CID 122317160
2-cyclopentyl-N-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 122317160) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-cyclopentyl-N-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 122317160 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-cyclopentyl-N-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | Cc1nc(Nc2ccc(NC(=O)CC3CCCC3)cc2)cc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C23H26N6O/c1-16-25-21(15-22(26-16)29-20-8-4-5-13-24-20)27-18-9-11-19(12-10-18)28-23(30)14-17-6-2-3-7-17/h4-5,8-13,15,17H,2-3,6-7,14H2,1H3,(H,28,30)(H2,24,25,26,27,29) |
| InChIKey | DSZDCKALOHDYCJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |