C18H18N4OS — CID 122317482
N-[(4-pyrrolidin-1-ylpyrimidin-2-yl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 122317482) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is N-[(4-pyrrolidin-1-ylpyrimidin-2-yl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(4-pyrrolidin-1-ylpyrimidin-2-yl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 122317482 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-[(4-pyrrolidin-1-ylpyrimidin-2-yl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCc1nccc(N2CCCC2)n1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C18H18N4OS/c23-18(15-11-13-5-1-2-6-14(13)24-15)20-12-16-19-8-7-17(21-16)22-9-3-4-10-22/h1-2,5-8,11H,3-4,9-10,12H2,(H,20,23) |
| InChIKey | NZNBTVPKJHITTB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |