C16H19N5O4S — CID 122318036
N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]-3-nitrobenzenesulfonamide (PubChem CID 122318036) has the molecular formula C16H19N5O4S and a molecular weight of 377.43 g/mol. Its IUPAC name is N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122318036 |
| Molecular Formula | C16H19N5O4S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1cc(N2CCCC2)nc(CNS(=O)(=O)c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C16H19N5O4S/c1-12-9-16(20-7-2-3-8-20)19-15(18-12)11-17-26(24,25)14-6-4-5-13(10-14)21(22)23/h4-6,9-10,17H,2-3,7-8,11H2,1H3 |
| InChIKey | HMMCZRXRBCYLTD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|