C19H20F2N4O — CID 122318606
(E)-3-(2,5-difluorophenyl)-N-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]prop-2-enamide (PubChem CID 122318606) has the molecular formula C19H20F2N4O and a molecular weight of 358.39 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-N-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-difluorophenyl)-N-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 122318606 |
| Molecular Formula | C19H20F2N4O |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-N-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(F)ccc1F)NCc1nccc(N2CCCCC2)n1 |
| InChI | InChI=1S/C19H20F2N4O/c20-15-5-6-16(21)14(12-15)4-7-19(26)23-13-17-22-9-8-18(24-17)25-10-2-1-3-11-25/h4-9,12H,1-3,10-11,13H2,(H,23,26)/b7-4+ |
| InChIKey | YEKSDLAUKHCFQG-QPJJXVBHSA-N |
| XLogP | 3.07 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|