C15H21N5O3 — CID 122318847
N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]-6-oxopiperidine-3-carboxamide (PubChem CID 122318847) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 122318847 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]-6-oxopiperidine-3-carboxamide |
| SMILES | O=C1CCC(C(=O)NCc2nccc(N3CCOCC3)n2)CN1 |
| InChI | InChI=1S/C15H21N5O3/c21-14-2-1-11(9-17-14)15(22)18-10-12-16-4-3-13(19-12)20-5-7-23-8-6-20/h3-4,11H,1-2,5-10H2,(H,17,21)(H,18,22) |
| InChIKey | UMCBKFBRMDRAPC-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |