C18H21F2N5O3 — CID 122319002
1-[3-(difluoromethoxy)phenyl]-3-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]urea (PubChem CID 122319002) has the molecular formula C18H21F2N5O3 and a molecular weight of 393.39 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]urea.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 122319002 |
| Molecular Formula | C18H21F2N5O3 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]urea |
| SMILES | Cc1cc(N2CCOCC2)nc(CNC(=O)Nc2cccc(OC(F)F)c2)n1 |
| InChI | InChI=1S/C18H21F2N5O3/c1-12-9-16(25-5-7-27-8-6-25)24-15(22-12)11-21-18(26)23-13-3-2-4-14(10-13)28-17(19)20/h2-4,9-10,17H,5-8,11H2,1H3,(H2,21,23,26) |
| InChIKey | COHMBLMHCSALEW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |