C15H17ClN4O2S — CID 122319076
5-chloro-N-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]thiophene-2-carboxamide (PubChem CID 122319076) has the molecular formula C15H17ClN4O2S and a molecular weight of 352.85 g/mol. Its IUPAC name is 5-chloro-N-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 122319076 |
| Molecular Formula | C15H17ClN4O2S |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 5-chloro-N-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)methyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(N2CCOCC2)nc(CNC(=O)c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C15H17ClN4O2S/c1-10-8-14(20-4-6-22-7-5-20)19-13(18-10)9-17-15(21)11-2-3-12(16)23-11/h2-3,8H,4-7,9H2,1H3,(H,17,21) |
| InChIKey | JJRNTNVBUYACOT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |