C17H22BrN5O2S — CID 122320377
4-bromo-N-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]benzenesulfonamide (PubChem CID 122320377) has the molecular formula C17H22BrN5O2S and a molecular weight of 440.37 g/mol. Its IUPAC name is 4-bromo-N-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 122320377 |
| Molecular Formula | C17H22BrN5O2S |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 4-bromo-N-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]benzenesulfonamide |
| SMILES | CN(C)c1nc(N2CCCCC2)ncc1NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H22BrN5O2S/c1-22(2)16-15(12-19-17(20-16)23-10-4-3-5-11-23)21-26(24,25)14-8-6-13(18)7-9-14/h6-9,12,21H,3-5,10-11H2,1-2H3 |
| InChIKey | PYNPIRJFPURPBN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |