C11H16F3N5O — CID 122320882
N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-3,3,3-trifluoropropanamide (PubChem CID 122320882) has the molecular formula C11H16F3N5O and a molecular weight of 291.28 g/mol. Its IUPAC name is N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 122320882 |
| Molecular Formula | C11H16F3N5O |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-[2-[[5-(dimethylamino)pyridazin-3-yl]amino]ethyl]-3,3,3-trifluoropropanamide |
| SMILES | CN(C)c1cnnc(NCCNC(=O)CC(F)(F)F)c1 |
| InChI | InChI=1S/C11H16F3N5O/c1-19(2)8-5-9(18-17-7-8)15-3-4-16-10(20)6-11(12,13)14/h5,7H,3-4,6H2,1-2H3,(H,15,18)(H,16,20) |
| InChIKey | SVVGZQTWSOOWSB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|