C13H18F3N5O2 — CID 122321665
3,3,3-trifluoro-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]propanamide (PubChem CID 122321665) has the molecular formula C13H18F3N5O2 and a molecular weight of 333.31 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 122321665 |
| Molecular Formula | C13H18F3N5O2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3,3,3-trifluoro-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]propanamide |
| SMILES | O=C(CC(F)(F)F)NCCNc1cc(N2CCOCC2)cnn1 |
| InChI | InChI=1S/C13H18F3N5O2/c14-13(15,16)8-12(22)18-2-1-17-11-7-10(9-19-20-11)21-3-5-23-6-4-21/h7,9H,1-6,8H2,(H,17,20)(H,18,22) |
| InChIKey | GMYODFMYFUBWAH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|