C22H23N7O — CID 122324098
2-(benzimidazol-1-yl)-N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 122324098) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is 2-(benzimidazol-1-yl)-N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | 2-(benzimidazol-1-yl)-N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 122324098 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-(benzimidazol-1-yl)-N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CCNc1cc(Nc2ccc(NC(=O)Cn3cnc4ccccc43)cc2)nc(C)n1 |
| InChI | InChI=1S/C22H23N7O/c1-3-23-20-12-21(26-15(2)25-20)27-16-8-10-17(11-9-16)28-22(30)13-29-14-24-18-6-4-5-7-19(18)29/h4-12,14H,3,13H2,1-2H3,(H,28,30)(H2,23,25,26,27) |
| InChIKey | DNZNIVYRFDJUTL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |