C19H27N5O — CID 122324495
N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-phenylbutanamide (PubChem CID 122324495) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-phenylbutanamide.
| Compound Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 122324495 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-phenylbutanamide |
| SMILES | CCNc1cc(C)nc(NCCNC(=O)C(CC)c2ccccc2)n1 |
| InChI | InChI=1S/C19H27N5O/c1-4-16(15-9-7-6-8-10-15)18(25)21-11-12-22-19-23-14(3)13-17(24-19)20-5-2/h6-10,13,16H,4-5,11-12H2,1-3H3,(H,21,25)(H2,20,22,23,24) |
| InChIKey | IRELRHFATGMBFZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|