C22H22N8O — CID 122325694
N-[4-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]phenyl]-2-phenyltriazole-4-carboxamide (PubChem CID 122325694) has the molecular formula C22H22N8O and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[4-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]phenyl]-2-phenyltriazole-4-carboxamide.
| Compound Name | N-[4-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]phenyl]-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 122325694 |
| Molecular Formula | C22H22N8O |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-[4-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]phenyl]-2-phenyltriazole-4-carboxamide |
| SMILES | CCNc1nc(C)cc(Nc2ccc(NC(=O)c3cnn(-c4ccccc4)n3)cc2)n1 |
| InChI | InChI=1S/C22H22N8O/c1-3-23-22-25-15(2)13-20(28-22)26-16-9-11-17(12-10-16)27-21(31)19-14-24-30(29-19)18-7-5-4-6-8-18/h4-14H,3H2,1-2H3,(H,27,31)(H2,23,25,26,28) |
| InChIKey | YUIHSMJFUNTSHC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |