C21H22BrN5O2 — CID 122325809
2-bromo-N-[4-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]phenyl]-5-methoxybenzamide (PubChem CID 122325809) has the molecular formula C21H22BrN5O2 and a molecular weight of 456.34 g/mol. Its IUPAC name is 2-bromo-N-[4-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]phenyl]-5-methoxybenzamide.
| Compound Name | 2-bromo-N-[4-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]phenyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 122325809 |
| Molecular Formula | C21H22BrN5O2 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 2-bromo-N-[4-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]phenyl]-5-methoxybenzamide |
| SMILES | CCNc1nc(C)cc(Nc2ccc(NC(=O)c3cc(OC)ccc3Br)cc2)n1 |
| InChI | InChI=1S/C21H22BrN5O2/c1-4-23-21-24-13(2)11-19(27-21)25-14-5-7-15(8-6-14)26-20(28)17-12-16(29-3)9-10-18(17)22/h5-12H,4H2,1-3H3,(H,26,28)(H2,23,24,25,27) |
| InChIKey | OXVHJIKTVRKLSM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |