C24H23N7O2 — CID 122326128
N-[4-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]quinoxaline-6-carboxamide (PubChem CID 122326128) has the molecular formula C24H23N7O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is N-[4-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]quinoxaline-6-carboxamide.
| Compound Name | N-[4-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 122326128 |
| Molecular Formula | C24H23N7O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-[4-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]quinoxaline-6-carboxamide |
| SMILES | Cc1cc(Nc2ccc(NC(=O)c3ccc4nccnc4c3)cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C24H23N7O2/c1-16-14-22(30-24(27-16)31-10-12-33-13-11-31)28-18-3-5-19(6-4-18)29-23(32)17-2-7-20-21(15-17)26-9-8-25-20/h2-9,14-15H,10-13H2,1H3,(H,29,32)(H,27,28,30) |
| InChIKey | LYPWLXISCZHXMA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |